CS(O)(O)NCCC(c1ccccc1)C(O)Nc1ccccn1
CN1CCN(C(O)Cc2cncnc2)CC1
This compound retains most of x1093 within the pocket which spans to two areas. A six-membered ring related to x0995 is substituted where these two fragments would overlap. The other is based on x0072 which connects to x0107 and is close enough for a C-C bond there. This compund would retain non-covalent interactions of the individual fragments. *This one contains the appropriate aromatic rings