CN1CCN(C(O)CC2CNCNC2)CC1
CC1CCNCC1NC(O)C(CCNS(C)(O)O)C1CCCCC1
This compound retains most of x1093 within the pocket which spans to two areas. A six-membered ring related to x0995 is substituted where these two fragments would overlap. The other is based on x0072 which connects to x0107 and is close enough for a C-C bond there. This compund would retain non-covalent interactions of the individual fragments.