Submission Details

Molecule(s):
CC(=O)N1CCN(S(=O)(=O)c2cccs2)CC1

MAK-UNK-6435e6c2-1

CC(=O)N1CCN(S(=O)(=O)c2cccs2)CC1

CC(=O)N1CCN(Cc2cccs2)CC1

MAK-UNK-6435e6c2-2

CC(=O)N1CCN(Cc2cccs2)CC1

CC(=O)N1CCN(Cc2ccsc2)CC1

MAK-UNK-6435e6c2-3

CC(=O)N1CCN(Cc2ccsc2)CC1

CC(=O)Nc1cccc(N2CCCC2=O)c1

MAK-UNK-6435e6c2-4

CC(=O)Nc1cccc(N2CCCC2=O)c1

CC(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1

MAK-UNK-6435e6c2-5

CC(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1

CC(=O)N1CCN(S(=O)(=O)c2c(F)cccc2F)CC1

MAK-UNK-6435e6c2-6

CC(=O)N1CCN(S(=O)(=O)c2c(F)cccc2F)CC1

CC(=O)N1CCN(S(=O)(=O)c2ccsc2)CC1

MAK-UNK-6435e6c2-10
Duplicate of:
MAK-UNK-4c6b313a-1

CC(=O)N1CCN(S(=O)(=O)c2ccsc2)CC1

CC(=O)N1CCN(S(=O)(=O)c2ccsc2)CC1

MAK-UNK-6435e6c2-11
Duplicate of:
MAK-UNK-4c6b313a-1

CC(=O)N1CCN(S(=O)(=O)c2ccsc2)CC1


Design Rationale:

x_0689 with a shifted S atom

Inspired By:
Discussion: