CN(C)C(=O)CN1CC(C(=O)Nc2cncc3ccccc23)c2cc(Cl)ccc2C1=O
The corresponding compound without the lactam carbonyl loses significant potency with the introduction of a tertiary amide. This compound will test whether or not that SAR translates to the lactam series, which generally enjoys greater metabolic stability. Removal of an H-bond donor and a slight increase in logP are expected to improve permeability.