Submission Details
Molecule(s):
CS(=O)(=O)NCN(C(=O)Nc1ccccc1)c1ccccc1
Design Rationale:
I chose these two fragments (0072 and 0434) to use because (after using Chimera and analyzing it by eye) I found that those two fragment almost overlap perfectly. Thus, I combined the two phenyl sections of the two fragments (that almost overlapped). There is one difference with a carbon and nitrogen atom in that overlap, but I don't see this significantly affecting the inhibitor overall. Also, they weren't perfectly overlapped, but I saw the space as so small that the little bit of shifting wouldn't affect any of the bonding with the inhibitor significantly enough as well.